What is the Diethanolmethylamine?

Diethanolmethylamine is colourless viscous liquid, while it's Molecular Formula is C5H13NO2. colourless viscous liquid Used in Corrosion Inhibition: Diethanolmethylamine is used as a corrosion inhibitor to protect metal surfaces from degradation and wear, enhancing the longevity and performance of materials in various applications. Used in Emulsion and Suspension Stabilization: Diethanolmethylamine serves as a stabilizer for emulsions and suspensions, ensuring their uniformity and preventing separation, which is crucial in industries such as pharmaceuticals, cosmetics, and food processing. Used as a Precursor in Pharmaceutical and Agrochemical Synthesis: Diethanolmethylamine is utilized as a precursor in the synthesis of various pharmaceuticals and agrochemicals, contributing to the development of new drugs and agricultural products. Used in Detergent Production: Diethanolmethylamine is employed in the production of detergents, where it enhances cleaning efficiency and improves the overall performance of the product. Used in Textile Auxiliaries: In the textile industry, Diethanolmethylamine is used as a component of textile auxiliaries, aiding in processes such as dyeing, printing, and finishing, to achieve desired properties in fabrics.

What is the CAS number for Diethanolmethylamine?

The CAS number of Diethanolmethylamine is 105-59-9.

What is Diethanolmethylamine (105-59-9) used for?

Diethanolmethylamine, also known as N,N-Dimethyl-2,2'-iminodiethanol, is a colorless, hygroscopic liquid with a fishy odor and the molecular formula C5H13NO2. It is a versatile chemical compound commonly used in various industries due to its unique properties.InChI:InChI=1/C5H13NO2/c1-6(2-4-7)3-5-8/h7-8H,2-5H2,1H3/p+1

What is the Diethanolmethylamine?

Diethanolmethylamine is colourless viscous liquid, while it's Molecular Formula is C5H13NO2. colourless viscous liquid Used in Corrosion Inhibition: Diethanolmethylamine is used as a corrosion inhibitor to protect metal surfaces from degradation and wear, enhancing the longevity and performance of materials in various applications. Used in Emulsion and Suspension Stabilization: Diethanolmethylamine serves as a stabilizer for emulsions and suspensions, ensuring their uniformity and preventing separation, which is crucial in industries such as pharmaceuticals, cosmetics, and food processing. Used as a Precursor in Pharmaceutical and Agrochemical Synthesis: Diethanolmethylamine is utilized as a precursor in the synthesis of various pharmaceuticals and agrochemicals, contributing to the development of new drugs and agricultural products. Used in Detergent Production: Diethanolmethylamine is employed in the production of detergents, where it enhances cleaning efficiency and improves the overall performance of the product. Used in Textile Auxiliaries: In the textile industry, Diethanolmethylamine is used as a component of textile auxiliaries, aiding in processes such as dyeing, printing, and finishing, to achieve desired properties in fabrics.

What is the CAS number for Diethanolmethylamine?

The CAS number of Diethanolmethylamine is 105-59-9.

What is Diethanolmethylamine (105-59-9) used for?

Diethanolmethylamine, also known as N,N-Dimethyl-2,2'-iminodiethanol, is a colorless, hygroscopic liquid with a fishy odor and the molecular formula C5H13NO2. It is a versatile chemical compound commonly used in various industries due to its unique properties.InChI:InChI=1/C5H13NO2/c1-6(2-4-7)3-5-8/h7-8H,2-5H2,1H3/p+1

Reputable supplier selling N-Methyldiethanolamine（MDEA） 105-59-9 with stock

 

Your Location：Home > Products > Catalysts and additives > N-Methyldiethanolamine（MDEA）

N-Methyldiethanolamine（MDEA）

Product Name
CasNo
MF
MW
Content
Appearance
Packing
Apply

N-Methyldiethanolamine（MDEA）
105-59-9
C₅H₁₃NO₂
119.164
colourless viscous liquid

Inquiry 

Reputable supplier selling N-Methyldiethanolamine（MDEA） 105-59-9 with stock

Molecular Formula:C5H13NO2
Molecular Weight:119.164
Appearance/Colour:colourless viscous liquid
Vapor Pressure:0.00431mmHg at 25°C
Melting Point:-21 °C
Refractive Index:n20/D 1.469(lit.)
Boiling Point:247 °C at 760 mmHg
PKA:14.41±0.10(Predicted)
Flash Point:126.7 °C
PSA：43.70000
Density:1.051 g/cm³
LogP:-1.09720

Diethanolmethylamine(Cas 105-59-9) Usage

General Description

Diethanolmethylamine, also known as N,N-Dimethyl-2,2'-iminodiethanol, is a chemical compound with the molecular formula C5H13NO2. It is a colorless, hygroscopic liquid with a fishy odor. Diethanolmethylamine is commonly used as a corrosion inhibitor, a stabilizer for emulsions and suspensions, and as a precursor for the synthesis of pharmaceuticals and agrochemicals. It is also used in the production of detergents, textile auxiliaries, and other industrial products. Diethanolmethylamine is considered to be a hazardous chemical and proper safety measures should be taken when handling and storing it.

InChI:InChI=1/C5H13NO2/c1-6(2-4-7)3-5-8/h7-8H,2-5H2,1H3/p+1